C40H40O6 — CID 11734771
(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(trityloxymethyl)oxan-3-ol (PubChem CID 11734771) has the molecular formula C40H40O6 and a molecular weight of 616.75 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(trityloxymethyl)oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(trityloxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 11734771 |
| Molecular Formula | C40H40O6 |
| Molecular Weight | 616.75 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | (2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(trityloxymethyl)oxan-3-ol |
| SMILES | CO[C@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H40O6/c1-42-39-38(44-28-31-19-9-3-10-20-31)37(43-27-30-17-7-2-8-18-30)36(41)35(46-39)29-45-40(32-21-11-4-12-22-32,33-23-13-5-14-24-33)34-25-15-6-16-26-34/h2-26,35-39,41H,27-29H2,1H3/t35-,36-,37+,38-,39+/m1/s1 |
| InChIKey | GZWDCFUAYQOXTM-QGVRFUEOSA-N |
| XLogP | 6.90 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.75 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|