C48H48O7 — CID 70896291
(2S,3S,4S,5R,6R)-2-methoxy-6-[[(2-methoxyphenyl)-diphenylmethoxy]methyl]-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 70896291) has the molecular formula C48H48O7 and a molecular weight of 736.91 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-methoxy-6-[[(2-methoxyphenyl)-diphenylmethoxy]methyl]-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2S,3S,4S,5R,6R)-2-methoxy-6-[[(2-methoxyphenyl)-diphenylmethoxy]methyl]-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 70896291 |
| Molecular Formula | C48H48O7 |
| Molecular Weight | 736.91 g/mol |
| Exact Mass | 736.34 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-methoxy-6-[[(2-methoxyphenyl)-diphenylmethoxy]methyl]-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | COc1ccccc1C(OC[C@H]1O[C@H](OC)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H48O7/c1-49-42-31-19-18-30-41(42)48(39-26-14-6-15-27-39,40-28-16-7-17-29-40)54-35-43-44(51-32-36-20-8-3-9-21-36)45(52-33-37-22-10-4-11-23-37)46(47(50-2)55-43)53-34-38-24-12-5-13-25-38/h3-31,43-47H,32-35H2,1-2H3/t43-,44-,45+,46+,47+/m1/s1 |
| InChIKey | CTLBYVXNYJACQH-ZXDZVNHNSA-N |
| XLogP | 9.13 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.91 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|