C43H44O6 — CID 15947732
(2S,3R,4S,5R,6R)-2-methoxy-3,4-bis(phenylmethoxy)-5-prop-2-enoxy-6-(trityloxymethyl)oxane (PubChem CID 15947732) has the molecular formula C43H44O6 and a molecular weight of 656.82 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-methoxy-3,4-bis(phenylmethoxy)-5-prop-2-enoxy-6-(trityloxymethyl)oxane.
| Compound Name | (2S,3R,4S,5R,6R)-2-methoxy-3,4-bis(phenylmethoxy)-5-prop-2-enoxy-6-(trityloxymethyl)oxane |
|---|---|
| PubChem CID | 15947732 |
| Molecular Formula | C43H44O6 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.31 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-methoxy-3,4-bis(phenylmethoxy)-5-prop-2-enoxy-6-(trityloxymethyl)oxane |
| SMILES | C=CCO[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](OC)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H44O6/c1-3-29-45-39-38(32-48-43(35-23-13-6-14-24-35,36-25-15-7-16-26-36)37-27-17-8-18-28-37)49-42(44-2)41(47-31-34-21-11-5-12-22-34)40(39)46-30-33-19-9-4-10-20-33/h3-28,38-42H,1,29-32H2,2H3/t38-,39-,40+,41-,42+/m1/s1 |
| InChIKey | QNPJIUMXRCFBCX-DJLQKWJRSA-N |
| XLogP | 8.11 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|