C42H41N3O5 — CID 14464068
(2R,3R,4R,5R,6R)-3-azido-4,5-bis(phenylmethoxy)-2-prop-2-enoxy-6-(trityloxymethyl)oxane (PubChem CID 14464068) has the molecular formula C42H41N3O5 and a molecular weight of 667.81 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-3-azido-4,5-bis(phenylmethoxy)-2-prop-2-enoxy-6-(trityloxymethyl)oxane.
| Compound Name | (2R,3R,4R,5R,6R)-3-azido-4,5-bis(phenylmethoxy)-2-prop-2-enoxy-6-(trityloxymethyl)oxane |
|---|---|
| PubChem CID | 14464068 |
| Molecular Formula | C42H41N3O5 |
| Molecular Weight | 667.81 g/mol |
| Exact Mass | 667.30 |
| IUPAC Name | (2R,3R,4R,5R,6R)-3-azido-4,5-bis(phenylmethoxy)-2-prop-2-enoxy-6-(trityloxymethyl)oxane |
| SMILES | C=CCO[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C42H41N3O5/c1-2-28-46-41-38(44-45-43)40(48-30-33-20-10-4-11-21-33)39(47-29-32-18-8-3-9-19-32)37(50-41)31-49-42(34-22-12-5-13-23-34,35-24-14-6-15-25-35)36-26-16-7-17-27-36/h2-27,37-41H,1,28-31H2/t37-,38-,39+,40-,41-/m1/s1 |
| InChIKey | NOHNTKXQDJJIRV-PGSFLWIGSA-N |
| XLogP | 8.77 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.81 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|