C54H60O7 — CID 71814240
8-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(trityloxymethyl)oxan-2-yl]oxyoctan-1-ol (PubChem CID 71814240) has the molecular formula C54H60O7 and a molecular weight of 821.07 g/mol. Its IUPAC name is 8-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(trityloxymethyl)oxan-2-yl]oxyoctan-1-ol.
| Compound Name | 8-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(trityloxymethyl)oxan-2-yl]oxyoctan-1-ol |
|---|---|
| PubChem CID | 71814240 |
| Molecular Formula | C54H60O7 |
| Molecular Weight | 821.07 g/mol |
| Exact Mass | 820.43 |
| IUPAC Name | 8-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(trityloxymethyl)oxan-2-yl]oxyoctan-1-ol |
| SMILES | OCCCCCCCCO[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C54H60O7/c55-37-23-3-1-2-4-24-38-56-53-52(59-41-45-29-15-7-16-30-45)51(58-40-44-27-13-6-14-28-44)50(57-39-43-25-11-5-12-26-43)49(61-53)42-60-54(46-31-17-8-18-32-46,47-33-19-9-20-34-47)48-35-21-10-22-36-48/h5-22,25-36,49-53,55H,1-4,23-24,37-42H2/t49-,50-,51+,52-,53-/m1/s1 |
| InChIKey | VWLKFFIMHXEEPA-GIPKGRTISA-N |
| XLogP | 10.83 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.07 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|