C32H35O15P3 — CID 124748579
[(2S,3R,4R,5R,6S)-2-phenylmethoxy-3,5-diphosphonooxy-6-(trityloxymethyl)oxan-4-yl] dihydrogen phosphate (PubChem CID 124748579) has the molecular formula C32H35O15P3 and a molecular weight of 752.54 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6S)-2-phenylmethoxy-3,5-diphosphonooxy-6-(trityloxymethyl)oxan-4-yl] dihydrogen phosphate.
| Compound Name | [(2S,3R,4R,5R,6S)-2-phenylmethoxy-3,5-diphosphonooxy-6-(trityloxymethyl)oxan-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 124748579 |
| Molecular Formula | C32H35O15P3 |
| Molecular Weight | 752.54 g/mol |
| Exact Mass | 752.12 |
| IUPAC Name | [(2S,3R,4R,5R,6S)-2-phenylmethoxy-3,5-diphosphonooxy-6-(trityloxymethyl)oxan-4-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)O[C@H]1[C@@H](OP(=O)(O)O)[C@@H](OCc2ccccc2)O[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1OP(=O)(O)O |
| InChI | InChI=1S/C32H35O15P3/c33-48(34,35)45-28-27(22-43-32(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26)44-31(42-21-23-13-5-1-6-14-23)30(47-50(39,40)41)29(28)46-49(36,37)38/h1-20,27-31H,21-22H2,(H2,33,34,35)(H2,36,37,38)(H2,39,40,41)/t27-,28+,29+,30+,31-/m0/s1 |
| InChIKey | YFEYXRCRDWNOGR-SEZOVNKOSA-N |
| XLogP | 4.37 |
| TPSA | 227.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|