C45H42O5S — CID 87877938
(2S,3R,4S,5R,6R)-5-phenoxy-3,4-bis(phenylmethoxy)-6-(trityloxymethyl)oxane-2-thiol (PubChem CID 87877938) has the molecular formula C45H42O5S and a molecular weight of 694.89 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-5-phenoxy-3,4-bis(phenylmethoxy)-6-(trityloxymethyl)oxane-2-thiol.
| Compound Name | (2S,3R,4S,5R,6R)-5-phenoxy-3,4-bis(phenylmethoxy)-6-(trityloxymethyl)oxane-2-thiol |
|---|---|
| PubChem CID | 87877938 |
| Molecular Formula | C45H42O5S |
| Molecular Weight | 694.89 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | (2S,3R,4S,5R,6R)-5-phenoxy-3,4-bis(phenylmethoxy)-6-(trityloxymethyl)oxane-2-thiol |
| SMILES | S[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](Oc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C45H42O5S/c51-44-43(47-32-35-21-9-2-10-22-35)42(46-31-34-19-7-1-8-20-34)41(49-39-29-17-6-18-30-39)40(50-44)33-48-45(36-23-11-3-12-24-36,37-25-13-4-14-26-37)38-27-15-5-16-28-38/h1-30,40-44,51H,31-33H2/t40-,41-,42+,43-,44+/m1/s1 |
| InChIKey | ARUGPMYLQNEYCB-IYFSMEFCSA-N |
| XLogP | 9.27 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.89 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|