C33H42O14 — CID 10908501
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-[(2S,3R,4S,5R,6R)-5-hydroxy-2-methoxy-3-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 10908501) has the molecular formula C33H42O14 and a molecular weight of 662.69 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-[(2S,3R,4S,5R,6R)-5-hydroxy-2-methoxy-3-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-[(2S,3R,4S,5R,6R)-5-hydroxy-2-methoxy-3-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10908501 |
| Molecular Formula | C33H42O14 |
| Molecular Weight | 662.69 g/mol |
| Exact Mass | 662.26 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-[(2S,3R,4S,5R,6R)-5-hydroxy-2-methoxy-3-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](O[C@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H42O14/c1-19(34)41-18-25-28(43-20(2)35)30(44-21(3)36)27(38)32(46-25)47-29-26(37)24(17-40-15-22-11-7-5-8-12-22)45-33(39-4)31(29)42-16-23-13-9-6-10-14-23/h5-14,24-33,37-38H,15-18H2,1-4H3/t24-,25-,26-,27-,28+,29+,30-,31-,32-,33+/m1/s1 |
| InChIKey | PCZOMBJPKZZIPD-JUJWBDIVSA-N |
| XLogP | 1.42 |
| TPSA | 174.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.69 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|