C40H48O14 — CID 10908829
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-[(2S,3R,4S,5R,6R)-2-methoxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 10908829) has the molecular formula C40H48O14 and a molecular weight of 752.81 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-[(2S,3R,4S,5R,6R)-2-methoxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-[(2S,3R,4S,5R,6R)-2-methoxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10908829 |
| Molecular Formula | C40H48O14 |
| Molecular Weight | 752.81 g/mol |
| Exact Mass | 752.30 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-[(2S,3R,4S,5R,6R)-2-methoxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](O[C@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H48O14/c1-25(41)47-24-32-35(50-26(2)42)36(51-27(3)43)33(44)39(52-32)54-37-34(48-21-29-16-10-6-11-17-29)31(23-46-20-28-14-8-5-9-15-28)53-40(45-4)38(37)49-22-30-18-12-7-13-19-30/h5-19,31-40,44H,20-24H2,1-4H3/t31-,32-,33-,34-,35+,36-,37+,38-,39-,40+/m1/s1 |
| InChIKey | BFVJTHLACQTZDE-DQVYRWEXSA-N |
| XLogP | 3.64 |
| TPSA | 163.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.81 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|