C29H31ClO7 — CID 132839002
3-chloro-1-hydroxy-1-[(2R,3S,4S,5R,6R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]propan-2-one (PubChem CID 132839002) has the molecular formula C29H31ClO7 and a molecular weight of 527.01 g/mol. Its IUPAC name is 3-chloro-1-hydroxy-1-[(2R,3S,4S,5R,6R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]propan-2-one.
| Compound Name | 3-chloro-1-hydroxy-1-[(2R,3S,4S,5R,6R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 132839002 |
| Molecular Formula | C29H31ClO7 |
| Molecular Weight | 527.01 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 3-chloro-1-hydroxy-1-[(2R,3S,4S,5R,6R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]propan-2-one |
| SMILES | O=C(CCl)C(O)[C@H]1O[C@@H](O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H31ClO7/c30-16-23(31)24(32)25-26(34-17-20-10-4-1-5-11-20)27(35-18-21-12-6-2-7-13-21)28(29(33)37-25)36-19-22-14-8-3-9-15-22/h1-15,24-29,32-33H,16-19H2/t24?,25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | MBLACKRIKZYGCC-IGCXXYHKSA-N |
| XLogP | 3.63 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.01 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|