C34H30O9 — CID 123835484
1-[(2S,3R,4S,5S,6S)-3,5-dibenzoyl-4-benzyl-3,4,5,6-tetrahydroxyoxan-2-yl]-2-hydroxy-2-phenylethanone (PubChem CID 123835484) has the molecular formula C34H30O9 and a molecular weight of 582.61 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5S,6S)-3,5-dibenzoyl-4-benzyl-3,4,5,6-tetrahydroxyoxan-2-yl]-2-hydroxy-2-phenylethanone.
| Compound Name | 1-[(2S,3R,4S,5S,6S)-3,5-dibenzoyl-4-benzyl-3,4,5,6-tetrahydroxyoxan-2-yl]-2-hydroxy-2-phenylethanone |
|---|---|
| PubChem CID | 123835484 |
| Molecular Formula | C34H30O9 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 1-[(2S,3R,4S,5S,6S)-3,5-dibenzoyl-4-benzyl-3,4,5,6-tetrahydroxyoxan-2-yl]-2-hydroxy-2-phenylethanone |
| SMILES | O=C(C(O)c1ccccc1)[C@H]1O[C@H](O)[C@](O)(C(=O)c2ccccc2)[C@](O)(Cc2ccccc2)[C@@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C34H30O9/c35-26(23-15-7-2-8-16-23)27(36)30-33(41,28(37)24-17-9-3-10-18-24)32(40,21-22-13-5-1-6-14-22)34(42,31(39)43-30)29(38)25-19-11-4-12-20-25/h1-20,26,30-31,35,39-42H,21H2/t26?,30-,31+,32+,33-,34-/m1/s1 |
| InChIKey | KKICLTACKIMENS-CHSCGUMISA-N |
| XLogP | 2.21 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |