C20H21N3O6 — CID 123482156
1-[(2S,3R,4R,5S,6S)-5-azido-4-benzyl-3,4,6-trihydroxyoxan-2-yl]-2-hydroxy-2-phenylethanone (PubChem CID 123482156) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5S,6S)-5-azido-4-benzyl-3,4,6-trihydroxyoxan-2-yl]-2-hydroxy-2-phenylethanone.
| Compound Name | 1-[(2S,3R,4R,5S,6S)-5-azido-4-benzyl-3,4,6-trihydroxyoxan-2-yl]-2-hydroxy-2-phenylethanone |
|---|---|
| PubChem CID | 123482156 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 1-[(2S,3R,4R,5S,6S)-5-azido-4-benzyl-3,4,6-trihydroxyoxan-2-yl]-2-hydroxy-2-phenylethanone |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](O)O[C@H](C(=O)C(O)c2ccccc2)[C@@H](O)[C@@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C20H21N3O6/c21-23-22-17-19(27)29-16(15(25)14(24)13-9-5-2-6-10-13)18(26)20(17,28)11-12-7-3-1-4-8-12/h1-10,14,16-19,24,26-28H,11H2/t14?,16-,17-,18-,19+,20-/m1/s1 |
| InChIKey | GFASFMFRRXMMDH-ASCLCNOTSA-N |
| XLogP | 1.02 |
| TPSA | 155.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|