C20H29N3O6 — CID 139486396
methyl 6-[(2S,3S,4S,5S,6S)-3-azido-5,6-dihydroxy-2-methyl-4-phenylmethoxyoxan-2-yl]hexanoate (PubChem CID 139486396) has the molecular formula C20H29N3O6 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl 6-[(2S,3S,4S,5S,6S)-3-azido-5,6-dihydroxy-2-methyl-4-phenylmethoxyoxan-2-yl]hexanoate.
| Compound Name | methyl 6-[(2S,3S,4S,5S,6S)-3-azido-5,6-dihydroxy-2-methyl-4-phenylmethoxyoxan-2-yl]hexanoate |
|---|---|
| PubChem CID | 139486396 |
| Molecular Formula | C20H29N3O6 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | methyl 6-[(2S,3S,4S,5S,6S)-3-azido-5,6-dihydroxy-2-methyl-4-phenylmethoxyoxan-2-yl]hexanoate |
| SMILES | COC(=O)CCCCC[C@]1(C)O[C@H](O)[C@@H](O)[C@@H](OCc2ccccc2)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C20H29N3O6/c1-20(12-8-4-7-11-15(24)27-2)18(22-23-21)17(16(25)19(26)29-20)28-13-14-9-5-3-6-10-14/h3,5-6,9-10,16-19,25-26H,4,7-8,11-13H2,1-2H3/t16-,17+,18-,19-,20-/m0/s1 |
| InChIKey | SFLVWQIWBPCHTE-WPVAHCMFSA-N |
| XLogP | 2.84 |
| TPSA | 133.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|