C34H42O6S — CID 101152765
methyl 6-[(2S,3R,4R,5S,6R)-6-methylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]hexanoate (PubChem CID 101152765) has the molecular formula C34H42O6S and a molecular weight of 578.77 g/mol. Its IUPAC name is methyl 6-[(2S,3R,4R,5S,6R)-6-methylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]hexanoate.
| Compound Name | methyl 6-[(2S,3R,4R,5S,6R)-6-methylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]hexanoate |
|---|---|
| PubChem CID | 101152765 |
| Molecular Formula | C34H42O6S |
| Molecular Weight | 578.77 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | methyl 6-[(2S,3R,4R,5S,6R)-6-methylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]hexanoate |
| SMILES | COC(=O)CCCCC[C@@H]1O[C@H](SC)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H42O6S/c1-36-30(35)22-14-6-13-21-29-31(37-23-26-15-7-3-8-16-26)32(38-24-27-17-9-4-10-18-27)33(34(40-29)41-2)39-25-28-19-11-5-12-20-28/h3-5,7-12,15-20,29,31-34H,6,13-14,21-25H2,1-2H3/t29-,31+,32+,33-,34+/m0/s1 |
| InChIKey | RMCFWSRBMSCKTD-FXBHKIKWSA-N |
| XLogP | 6.95 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.77 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|