C21H28N4O5 — CID 163263295
benzyl 6-[(3aS,7S,7aR)-7-azido-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]-6-oxohexanoate (PubChem CID 163263295) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is benzyl 6-[(3aS,7S,7aR)-7-azido-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]-6-oxohexanoate.
| Compound Name | benzyl 6-[(3aS,7S,7aR)-7-azido-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 163263295 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | benzyl 6-[(3aS,7S,7aR)-7-azido-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]-6-oxohexanoate |
| SMILES | CC1(C)O[C@@H]2[C@@H](N=[N+]=[N-])CN(C(=O)CCCCC(=O)OCc3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C21H28N4O5/c1-21(2)29-17-13-25(12-16(23-24-22)20(17)30-21)18(26)10-6-7-11-19(27)28-14-15-8-4-3-5-9-15/h3-5,8-9,16-17,20H,6-7,10-14H2,1-2H3/t16-,17-,20+/m0/s1 |
| InChIKey | GTPTVWNIIYWPSW-ABSDTBQOSA-N |
| XLogP | 3.33 |
| TPSA | 113.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|