C12H14N4O3 — CID 15965761
benzyl (3R,4S)-3-azido-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 15965761) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is benzyl (3R,4S)-3-azido-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | benzyl (3R,4S)-3-azido-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15965761 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | benzyl (3R,4S)-3-azido-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | [N-]=[N+]=N[C@@H]1CN(C(=O)OCc2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C12H14N4O3/c13-15-14-10-6-16(7-11(10)17)12(18)19-8-9-4-2-1-3-5-9/h1-5,10-11,17H,6-8H2/t10-,11+/m1/s1 |
| InChIKey | RIMVJYHSULPFSY-MNOVXSKESA-N |
| XLogP | 1.68 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|