C41H32O11 — CID 22848822
phenyl-[(1S,2R,4S,5R)-2,3,4,5-tetrabenzoyl-1,2,3,4,5,6-hexahydroxycyclohexyl]methanone (PubChem CID 22848822) has the molecular formula C41H32O11 and a molecular weight of 700.70 g/mol. Its IUPAC name is phenyl-[(1S,2R,4S,5R)-2,3,4,5-tetrabenzoyl-1,2,3,4,5,6-hexahydroxycyclohexyl]methanone.
| Compound Name | phenyl-[(1S,2R,4S,5R)-2,3,4,5-tetrabenzoyl-1,2,3,4,5,6-hexahydroxycyclohexyl]methanone |
|---|---|
| PubChem CID | 22848822 |
| Molecular Formula | C41H32O11 |
| Molecular Weight | 700.70 g/mol |
| Exact Mass | 700.19 |
| IUPAC Name | phenyl-[(1S,2R,4S,5R)-2,3,4,5-tetrabenzoyl-1,2,3,4,5,6-hexahydroxycyclohexyl]methanone |
| SMILES | O=C(c1ccccc1)C1(O)[C@](O)(C(=O)c2ccccc2)[C@@](O)(C(=O)c2ccccc2)C(O)[C@@](O)(C(=O)c2ccccc2)[C@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C41H32O11/c42-31(26-16-6-1-7-17-26)37(48)36(47)38(49,32(43)27-18-8-2-9-19-27)40(51,34(45)29-22-12-4-13-23-29)41(52,35(46)30-24-14-5-15-25-30)39(37,50)33(44)28-20-10-3-11-21-28/h1-25,36,47-52H/t36?,37-,38+,39+,40-,41? |
| InChIKey | ZGTUDJGQAAYHQJ-QWVFVTBUSA-N |
| XLogP | 2.43 |
| TPSA | 206.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.70 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |