C26H22O8 — CID 164897096
[(2R,3R,4S,5S)-4,5-dibenzoyl-3,4,5-trihydroxy-2-(hydroxymethyl)oxolan-3-yl]-phenylmethanone (PubChem CID 164897096) has the molecular formula C26H22O8 and a molecular weight of 462.45 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-4,5-dibenzoyl-3,4,5-trihydroxy-2-(hydroxymethyl)oxolan-3-yl]-phenylmethanone.
| Compound Name | [(2R,3R,4S,5S)-4,5-dibenzoyl-3,4,5-trihydroxy-2-(hydroxymethyl)oxolan-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 164897096 |
| Molecular Formula | C26H22O8 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [(2R,3R,4S,5S)-4,5-dibenzoyl-3,4,5-trihydroxy-2-(hydroxymethyl)oxolan-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@]1(O)[C@@](O)(C(=O)c2ccccc2)[C@@H](CO)O[C@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H22O8/c27-16-20-24(31,21(28)17-10-4-1-5-11-17)25(32,22(29)18-12-6-2-7-13-18)26(33,34-20)23(30)19-14-8-3-9-15-19/h1-15,20,27,31-33H,16H2/t20-,24+,25-,26-/m1/s1 |
| InChIKey | HFVMNZDMNDCPSZ-JFWNMISASA-N |
| XLogP | 1.18 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |