C27H24O9 — CID 91441037
[(1S,2R,3S,4S,5S,6R)-3,4-dibenzoyl-1,2,3,4,5,6-hexahydroxycyclohexyl]-phenylmethanone (PubChem CID 91441037) has the molecular formula C27H24O9 and a molecular weight of 492.48 g/mol. Its IUPAC name is [(1S,2R,3S,4S,5S,6R)-3,4-dibenzoyl-1,2,3,4,5,6-hexahydroxycyclohexyl]-phenylmethanone.
| Compound Name | [(1S,2R,3S,4S,5S,6R)-3,4-dibenzoyl-1,2,3,4,5,6-hexahydroxycyclohexyl]-phenylmethanone |
|---|---|
| PubChem CID | 91441037 |
| Molecular Formula | C27H24O9 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | [(1S,2R,3S,4S,5S,6R)-3,4-dibenzoyl-1,2,3,4,5,6-hexahydroxycyclohexyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@]1(O)[C@H](O)[C@H](O)[C@@](O)(C(=O)c2ccccc2)[C@](O)(C(=O)c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C27H24O9/c28-19(16-10-4-1-5-11-16)25(34)22(31)23(32)26(35,20(29)17-12-6-2-7-13-17)27(36,24(25)33)21(30)18-14-8-3-9-15-18/h1-15,22-24,31-36H/t22-,23+,24-,25+,26+,27+/m1/s1 |
| InChIKey | DYHZOEIIQXZTQW-ZPJGBUAPSA-N |
| XLogP | -0.08 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |