C26H21FO8 — CID 174859945
[(2R,3R,4R,5S)-2,4-dibenzoyl-3,4-dihydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypofluorite (PubChem CID 174859945) has the molecular formula C26H21FO8 and a molecular weight of 480.44 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,4-dibenzoyl-3,4-dihydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypofluorite.
| Compound Name | [(2R,3R,4R,5S)-2,4-dibenzoyl-3,4-dihydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypofluorite |
|---|---|
| PubChem CID | 174859945 |
| Molecular Formula | C26H21FO8 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | [(2R,3R,4R,5S)-2,4-dibenzoyl-3,4-dihydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl] hypofluorite |
| SMILES | O=C(c1ccccc1)C(O)[C@@H]1O[C@](OF)(C(=O)c2ccccc2)[C@H](O)[C@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H21FO8/c27-35-26(22(31)18-14-8-3-9-15-18)24(32)25(33,21(30)17-12-6-2-7-13-17)23(34-26)20(29)19(28)16-10-4-1-5-11-16/h1-15,20,23-24,29,32-33H/t20?,23-,24+,25-,26-/m0/s1 |
| InChIKey | CLGHQQWOSIDFSV-HNSHEHMYSA-N |
| XLogP | 2.08 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |