C26H21BrO8 — CID 154221957
2-[(2R,3R,4S)-3,4-dibenzoyl-5-bromo-3,4,5-trihydroxyoxolan-2-yl]-2-hydroxy-1-phenylethanone (PubChem CID 154221957) has the molecular formula C26H21BrO8 and a molecular weight of 541.35 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-3,4-dibenzoyl-5-bromo-3,4,5-trihydroxyoxolan-2-yl]-2-hydroxy-1-phenylethanone.
| Compound Name | 2-[(2R,3R,4S)-3,4-dibenzoyl-5-bromo-3,4,5-trihydroxyoxolan-2-yl]-2-hydroxy-1-phenylethanone |
|---|---|
| PubChem CID | 154221957 |
| Molecular Formula | C26H21BrO8 |
| Molecular Weight | 541.35 g/mol |
| Exact Mass | 540.04 |
| IUPAC Name | 2-[(2R,3R,4S)-3,4-dibenzoyl-5-bromo-3,4,5-trihydroxyoxolan-2-yl]-2-hydroxy-1-phenylethanone |
| SMILES | O=C(c1ccccc1)C(O)[C@H]1OC(O)(Br)[C@@](O)(C(=O)c2ccccc2)[C@@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H21BrO8/c27-26(34)25(33,22(31)18-14-8-3-9-15-18)24(32,21(30)17-12-6-2-7-13-17)23(35-26)20(29)19(28)16-10-4-1-5-11-16/h1-15,20,23,29,32-34H/t20?,23-,24-,25-,26?/m1/s1 |
| InChIKey | KUXBZVBWCSSSLE-PJJZGAISSA-N |
| XLogP | 1.90 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|