C28H21Cl2NO8 — CID 88669624
2-[(2S,3R,4R,5R)-3,4-dibenzoyl-2,5-dichloro-3,4,6-trihydroxy-6-isocyanooxan-2-yl]-2-hydroxy-1-phenylethanone (PubChem CID 88669624) has the molecular formula C28H21Cl2NO8 and a molecular weight of 570.38 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-3,4-dibenzoyl-2,5-dichloro-3,4,6-trihydroxy-6-isocyanooxan-2-yl]-2-hydroxy-1-phenylethanone.
| Compound Name | 2-[(2S,3R,4R,5R)-3,4-dibenzoyl-2,5-dichloro-3,4,6-trihydroxy-6-isocyanooxan-2-yl]-2-hydroxy-1-phenylethanone |
|---|---|
| PubChem CID | 88669624 |
| Molecular Formula | C28H21Cl2NO8 |
| Molecular Weight | 570.38 g/mol |
| Exact Mass | 569.06 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-3,4-dibenzoyl-2,5-dichloro-3,4,6-trihydroxy-6-isocyanooxan-2-yl]-2-hydroxy-1-phenylethanone |
| SMILES | [C-]#[N+]C1(O)O[C@](Cl)(C(O)C(=O)c2ccccc2)[C@](O)(C(=O)c2ccccc2)[C@@](O)(C(=O)c2ccccc2)[C@H]1Cl |
| InChI | InChI=1S/C28H21Cl2NO8/c1-31-28(38)24(29)25(36,21(33)18-13-7-3-8-14-18)26(37,22(34)19-15-9-4-10-16-19)27(30,39-28)23(35)20(32)17-11-5-2-6-12-17/h2-16,23-24,35-38H/t23?,24-,25-,26+,27-,28?/m1/s1 |
| InChIKey | FSRWRMPKBXUQOW-RVZZJEPTSA-N |
| XLogP | 2.60 |
| TPSA | 145.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|