C13H10Cl2O — CID 174997196
(1,6-dichlorocyclohexa-2,4-dien-1-yl)-phenylmethanone (PubChem CID 174997196) has the molecular formula C13H10Cl2O and a molecular weight of 253.13 g/mol. Its IUPAC name is (1,6-dichlorocyclohexa-2,4-dien-1-yl)-phenylmethanone.
| Compound Name | (1,6-dichlorocyclohexa-2,4-dien-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 174997196 |
| Molecular Formula | C13H10Cl2O |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | (1,6-dichlorocyclohexa-2,4-dien-1-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1(Cl)C=CC=CC1Cl |
| InChI | InChI=1S/C13H10Cl2O/c14-11-8-4-5-9-13(11,15)12(16)10-6-2-1-3-7-10/h1-9,11H |
| InChIKey | KNKPAXIBILWOBG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|