About 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone
1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 150946013) has the molecular formula C8H8Cl2O
and a molecular weight of 191.06 g/mol. Its IUPAC name is 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone |
| PubChem CID | 150946013 |
| Molecular Formula | C8H8Cl2O |
| Molecular Weight | 191.06 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone |
| SMILES | CC(=O)C1(Cl)C=CC=CC1Cl |
| InChI | InChI=1S/C8H8Cl2O/c1-6(11)8(10)5-3-2-4-7(8)9/h2-5,7H,1H3 |
| InChIKey | LJBIOPUHVBDSFC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.06 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone?
The IUPAC name of 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone (CID 150946013) is 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone.
What is the SMILES notation for 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone?
The canonical SMILES for 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone is CC(=O)C1(Cl)C=CC=CC1Cl.
What is the InChIKey of 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone?
The InChIKey is LJBIOPUHVBDSFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2O/c1-6(11)8(10)5-3-2-4-7(8)9/h2-5,7H,1H3.
What are the key properties of 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone?
1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone has a molecular weight of 191.06 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,6-dichlorocyclohexa-2,4-dien-1-yl)ethanone is sourced from PubChem (CID 150946013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).