C8H8Cl2O2 — CID 152697783
1-(1,5-dichloro-6-hydroxycyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 152697783) has the molecular formula C8H8Cl2O2 and a molecular weight of 207.06 g/mol. Its IUPAC name is 1-(1,5-dichloro-6-hydroxycyclohexa-2,4-dien-1-yl)ethanone.
| Compound Name | 1-(1,5-dichloro-6-hydroxycyclohexa-2,4-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 152697783 |
| Molecular Formula | C8H8Cl2O2 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 1-(1,5-dichloro-6-hydroxycyclohexa-2,4-dien-1-yl)ethanone |
| SMILES | CC(=O)C1(Cl)C=CC=C(Cl)C1O |
| InChI | InChI=1S/C8H8Cl2O2/c1-5(11)8(10)4-2-3-6(9)7(8)12/h2-4,7,12H,1H3 |
| InChIKey | ZQXWVZPBAPTKHR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|