About 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride
5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride (PubChem CID 173295029) has the molecular formula C9H10Cl2O
and a molecular weight of 205.08 g/mol. Its IUPAC name is 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride.
Molecular Properties
| Compound Name | 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride |
| PubChem CID | 173295029 |
| Molecular Formula | C9H10Cl2O |
| Molecular Weight | 205.08 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride |
| SMILES | CC1C(C(=O)Cl)=CC=CC1(C)Cl |
| InChI | InChI=1S/C9H10Cl2O/c1-6-7(8(10)12)4-3-5-9(6,2)11/h3-6H,1-2H3 |
| InChIKey | DSZRWLMGBBIAQP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.08 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride?
The IUPAC name of 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride (CID 173295029) is 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride.
What is the SMILES notation for 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride?
The canonical SMILES for 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride is CC1C(C(=O)Cl)=CC=CC1(C)Cl.
What is the InChIKey of 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride?
The InChIKey is DSZRWLMGBBIAQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2O/c1-6-7(8(10)12)4-3-5-9(6,2)11/h3-6H,1-2H3.
What are the key properties of 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride?
5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride has a molecular weight of 205.08 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride is sourced from PubChem (CID 173295029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).