C9H10Cl2O — CID 173295029
5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride (PubChem CID 173295029) has the molecular formula C9H10Cl2O and a molecular weight of 205.08 g/mol. Its IUPAC name is 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride.
| Compound Name | 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride |
|---|---|
| PubChem CID | 173295029 |
| Molecular Formula | C9H10Cl2O |
| Molecular Weight | 205.08 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 5-chloro-5,6-dimethylcyclohexa-1,3-diene-1-carbonyl chloride |
| SMILES | CC1C(C(=O)Cl)=CC=CC1(C)Cl |
| InChI | InChI=1S/C9H10Cl2O/c1-6-7(8(10)12)4-3-5-9(6,2)11/h3-6H,1-2H3 |
| InChIKey | DSZRWLMGBBIAQP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.08 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|