C9H11ClO — CID 19367926
6,6-dimethylcyclohexa-2,4-diene-1-carbonyl chloride (PubChem CID 19367926) has the molecular formula C9H11ClO and a molecular weight of 170.64 g/mol. Its IUPAC name is 6,6-dimethylcyclohexa-2,4-diene-1-carbonyl chloride.
| Compound Name | 6,6-dimethylcyclohexa-2,4-diene-1-carbonyl chloride |
|---|---|
| PubChem CID | 19367926 |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 6,6-dimethylcyclohexa-2,4-diene-1-carbonyl chloride |
| SMILES | CC1(C)C=CC=CC1C(=O)Cl |
| InChI | InChI=1S/C9H11ClO/c1-9(2)6-4-3-5-7(9)8(10)11/h3-7H,1-2H3 |
| InChIKey | JOVNSUBQNMZRNI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|