C8H7ClF2O — CID 97303738
2-chloro-1-[(1R)-6,6-difluorocyclohexa-2,4-dien-1-yl]ethanone (PubChem CID 97303738) has the molecular formula C8H7ClF2O and a molecular weight of 192.59 g/mol. Its IUPAC name is 2-chloro-1-[(1R)-6,6-difluorocyclohexa-2,4-dien-1-yl]ethanone.
| Compound Name | 2-chloro-1-[(1R)-6,6-difluorocyclohexa-2,4-dien-1-yl]ethanone |
|---|---|
| PubChem CID | 97303738 |
| Molecular Formula | C8H7ClF2O |
| Molecular Weight | 192.59 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 2-chloro-1-[(1R)-6,6-difluorocyclohexa-2,4-dien-1-yl]ethanone |
| SMILES | O=C(CCl)[C@H]1C=CC=CC1(F)F |
| InChI | InChI=1S/C8H7ClF2O/c9-5-7(12)6-3-1-2-4-8(6,10)11/h1-4,6H,5H2/t6-/m1/s1 |
| InChIKey | SPMZIZFQQQMPEB-ZCFIWIBFSA-N |
| XLogP | 2.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.59 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|