C7H6FNO4 — CID 87391076
6-fluoro-6-nitrocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 87391076) has the molecular formula C7H6FNO4 and a molecular weight of 187.13 g/mol. Its IUPAC name is 6-fluoro-6-nitrocyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-fluoro-6-nitrocyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 87391076 |
| Molecular Formula | C7H6FNO4 |
| Molecular Weight | 187.13 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | 6-fluoro-6-nitrocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C=CC=CC1(F)[N+](=O)[O-] |
| InChI | InChI=1S/C7H6FNO4/c8-7(9(12)13)4-2-1-3-5(7)6(10)11/h1-5H,(H,10,11) |
| InChIKey | ZDAXKKIXSCEDHK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|