C8H10F2O — CID 141411641
2-[(1S)-6,6-difluorocyclohexa-2,4-dien-1-yl]ethanol (PubChem CID 141411641) has the molecular formula C8H10F2O and a molecular weight of 160.16 g/mol. Its IUPAC name is 2-[(1S)-6,6-difluorocyclohexa-2,4-dien-1-yl]ethanol.
| Compound Name | 2-[(1S)-6,6-difluorocyclohexa-2,4-dien-1-yl]ethanol |
|---|---|
| PubChem CID | 141411641 |
| Molecular Formula | C8H10F2O |
| Molecular Weight | 160.16 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-[(1S)-6,6-difluorocyclohexa-2,4-dien-1-yl]ethanol |
| SMILES | OCC[C@H]1C=CC=CC1(F)F |
| InChI | InChI=1S/C8H10F2O/c9-8(10)5-2-1-3-7(8)4-6-11/h1-3,5,7,11H,4,6H2/t7-/m1/s1 |
| InChIKey | NFNCFNYWUQFZMN-SSDOTTSWSA-N |
| XLogP | 1.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |