C15H15BF3NO3 — CID 172746463
[4-[2-(6,6-difluorocyclohexa-2,4-dien-1-yl)ethylcarbamoyl]-2-fluorophenyl]boronic acid (PubChem CID 172746463) has the molecular formula C15H15BF3NO3 and a molecular weight of 325.10 g/mol. Its IUPAC name is [4-[2-(6,6-difluorocyclohexa-2,4-dien-1-yl)ethylcarbamoyl]-2-fluorophenyl]boronic acid.
| Compound Name | [4-[2-(6,6-difluorocyclohexa-2,4-dien-1-yl)ethylcarbamoyl]-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 172746463 |
| Molecular Formula | C15H15BF3NO3 |
| Molecular Weight | 325.10 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [4-[2-(6,6-difluorocyclohexa-2,4-dien-1-yl)ethylcarbamoyl]-2-fluorophenyl]boronic acid |
| SMILES | O=C(NCCC1C=CC=CC1(F)F)c1ccc(B(O)O)c(F)c1 |
| InChI | InChI=1S/C15H15BF3NO3/c17-13-9-10(4-5-12(13)16(22)23)14(21)20-8-6-11-3-1-2-7-15(11,18)19/h1-5,7,9,11,22-23H,6,8H2,(H,20,21) |
| InChIKey | JUERMHXULNFWCP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.10 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|