C23H22B2F2N2O7 — CID 174075137
3-[[(4-borono-3-fluorobenzoyl)amino]methyl]-5-[[(4-borono-3-fluorophenyl)methylamino]methyl]benzoic acid (PubChem CID 174075137) has the molecular formula C23H22B2F2N2O7 and a molecular weight of 498.06 g/mol. Its IUPAC name is 3-[[(4-borono-3-fluorobenzoyl)amino]methyl]-5-[[(4-borono-3-fluorophenyl)methylamino]methyl]benzoic acid.
| Compound Name | 3-[[(4-borono-3-fluorobenzoyl)amino]methyl]-5-[[(4-borono-3-fluorophenyl)methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 174075137 |
| Molecular Formula | C23H22B2F2N2O7 |
| Molecular Weight | 498.06 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 3-[[(4-borono-3-fluorobenzoyl)amino]methyl]-5-[[(4-borono-3-fluorophenyl)methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1cc(CNCc2ccc(B(O)O)c(F)c2)cc(CNC(=O)c2ccc(B(O)O)c(F)c2)c1 |
| InChI | InChI=1S/C23H22B2F2N2O7/c26-20-8-13(1-3-18(20)24(33)34)10-28-11-14-5-15(7-17(6-14)23(31)32)12-29-22(30)16-2-4-19(25(35)36)21(27)9-16/h1-9,28,33-36H,10-12H2,(H,29,30)(H,31,32) |
| InChIKey | POSQGZSDSIQDHB-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.06 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|