C9H11BFNO3 — CID 57497293
[4-(ethylcarbamoyl)-2-fluorophenyl]boronic acid (PubChem CID 57497293) has the molecular formula C9H11BFNO3 and a molecular weight of 211.00 g/mol. Its IUPAC name is [4-(ethylcarbamoyl)-2-fluorophenyl]boronic acid.
| Compound Name | [4-(ethylcarbamoyl)-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 57497293 |
| Molecular Formula | C9H11BFNO3 |
| Molecular Weight | 211.00 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | [4-(ethylcarbamoyl)-2-fluorophenyl]boronic acid |
| SMILES | CCNC(=O)c1ccc(B(O)O)c(F)c1 |
| InChI | InChI=1S/C9H11BFNO3/c1-2-12-9(13)6-3-4-7(10(14)15)8(11)5-6/h3-5,14-15H,2H2,1H3,(H,12,13) |
| InChIKey | RVPOYQNEOOWSAW-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.00 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|