C11H14FIN2O — CID 119508880
N-[2-(ethylamino)ethyl]-3-fluoro-4-iodobenzamide (PubChem CID 119508880) has the molecular formula C11H14FIN2O and a molecular weight of 336.15 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3-fluoro-4-iodobenzamide.
| Compound Name | N-[2-(ethylamino)ethyl]-3-fluoro-4-iodobenzamide |
|---|---|
| PubChem CID | 119508880 |
| Molecular Formula | C11H14FIN2O |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3-fluoro-4-iodobenzamide |
| SMILES | CCNCCNC(=O)c1ccc(I)c(F)c1 |
| InChI | InChI=1S/C11H14FIN2O/c1-2-14-5-6-15-11(16)8-3-4-10(13)9(12)7-8/h3-4,7,14H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | LCSOPNKJHFWFLQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|