C13H19ClFIN2O — CID 119571597
N-[3-(aminomethyl)pentan-3-yl]-3-fluoro-4-iodobenzamide;hydrochloride (PubChem CID 119571597) has the molecular formula C13H19ClFIN2O and a molecular weight of 400.66 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-3-fluoro-4-iodobenzamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-3-fluoro-4-iodobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119571597 |
| Molecular Formula | C13H19ClFIN2O |
| Molecular Weight | 400.66 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-3-fluoro-4-iodobenzamide;hydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)c1ccc(I)c(F)c1.Cl |
| InChI | InChI=1S/C13H18FIN2O.ClH/c1-3-13(4-2,8-16)17-12(18)9-5-6-11(15)10(14)7-9;/h5-7H,3-4,8,16H2,1-2H3,(H,17,18);1H |
| InChIKey | KJZOARNQAOEMMM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.66 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|