C18H18B2F2N2O8 — CID 142587652
(2S)-2,4-bis[(4-borono-3-fluorobenzoyl)amino]butanoic acid (PubChem CID 142587652) has the molecular formula C18H18B2F2N2O8 and a molecular weight of 449.97 g/mol. Its IUPAC name is (2S)-2,4-bis[(4-borono-3-fluorobenzoyl)amino]butanoic acid.
| Compound Name | (2S)-2,4-bis[(4-borono-3-fluorobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 142587652 |
| Molecular Formula | C18H18B2F2N2O8 |
| Molecular Weight | 449.97 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (2S)-2,4-bis[(4-borono-3-fluorobenzoyl)amino]butanoic acid |
| SMILES | O=C(NCC[C@H](NC(=O)c1ccc(B(O)O)c(F)c1)C(=O)O)c1ccc(B(O)O)c(F)c1 |
| InChI | InChI=1S/C18H18B2F2N2O8/c21-13-7-9(1-3-11(13)19(29)30)16(25)23-6-5-15(18(27)28)24-17(26)10-2-4-12(20(31)32)14(22)8-10/h1-4,7-8,15,29-32H,5-6H2,(H,23,25)(H,24,26)(H,27,28)/t15-/m0/s1 |
| InChIKey | SNAPCMGWKWKWID-HNNXBMFYSA-N |
| XLogP | -2.67 |
| TPSA | 176.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.97 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|