2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid

C19H20N2O10 — CID 15957861

IUPAC2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid
SMILESO=C(NCCCC(NC(=O)c1cc(O)c(O)c(O)c1)C(=O)O)c1cc(O)c(O)c(O)c1
InChIInChI=1S/C19H20N2O10/c22-11-4-8(5-12(23)15(11)26)17(28)20-3-1-2-10(19(30)31)21-18(29)9-6-13(24)16(27)14(25)7-9/h4-7,10,22-27H,1-3H2,(H,20,28)(H,21,29)(H,30,31)
InChIKeySEKAUTOELDKFPJ-UHFFFAOYSA-N
MW436.37 g/mol
LogP0.31
Rot. Bonds8

About 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid

2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid (PubChem CID 15957861) has the molecular formula C19H20N2O10 and a molecular weight of 436.37 g/mol. Its IUPAC name is 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid.

Molecular Properties

Compound Name2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid
PubChem CID15957861
Molecular FormulaC19H20N2O10
Molecular Weight436.37 g/mol
Exact Mass436.11
IUPAC Name2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid
SMILESO=C(NCCCC(NC(=O)c1cc(O)c(O)c(O)c1)C(=O)O)c1cc(O)c(O)c(O)c1
InChIInChI=1S/C19H20N2O10/c22-11-4-8(5-12(23)15(11)26)17(28)20-3-1-2-10(19(30)31)21-18(29)9-6-13(24)16(27)14(25)7-9/h4-7,10,22-27H,1-3H2,(H,20,28)(H,21,29)(H,30,31)
InChIKeySEKAUTOELDKFPJ-UHFFFAOYSA-N
XLogP0.31
TPSA216.88 Ų
H-Bond Donors9
H-Bond Acceptors9
Rotatable Bonds8
Heavy Atoms31
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500436.37
LogP ≤ 50.31
H-Bond Donors ≤ 59
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid?
The IUPAC name of 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid (CID 15957861) is 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid.
What is the SMILES notation for 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid?
The canonical SMILES for 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid is O=C(NCCCC(NC(=O)c1cc(O)c(O)c(O)c1)C(=O)O)c1cc(O)c(O)c(O)c1.
What is the InChIKey of 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid?
The InChIKey is SEKAUTOELDKFPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O10/c22-11-4-8(5-12(23)15(11)26)17(28)20-3-1-2-10(19(30)31)21-18(29)9-6-13(24)16(27)14(25)7-9/h4-7,10,22-27H,1-3H2,(H,20,28)(H,21,29)(H,30,31).
What are the key properties of 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid?
2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid has a molecular weight of 436.37 g/mol, XLogP of 0.31, 8 rotatable bonds, 9 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid is sourced from PubChem (CID 15957861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).