C19H20N2O10 — CID 15957861
2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid (PubChem CID 15957861) has the molecular formula C19H20N2O10 and a molecular weight of 436.37 g/mol. Its IUPAC name is 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid.
| Compound Name | 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 15957861 |
| Molecular Formula | C19H20N2O10 |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2,5-bis[(3,4,5-trihydroxybenzoyl)amino]pentanoic acid |
| SMILES | O=C(NCCCC(NC(=O)c1cc(O)c(O)c(O)c1)C(=O)O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C19H20N2O10/c22-11-4-8(5-12(23)15(11)26)17(28)20-3-1-2-10(19(30)31)21-18(29)9-6-13(24)16(27)14(25)7-9/h4-7,10,22-27H,1-3H2,(H,20,28)(H,21,29)(H,30,31) |
| InChIKey | SEKAUTOELDKFPJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 216.88 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|