C17H16N2O10 — CID 15957853
3-[(2,3,4-trihydroxybenzoyl)amino]-2-[(3,4,5-trihydroxybenzoyl)amino]propanoic acid (PubChem CID 15957853) has the molecular formula C17H16N2O10 and a molecular weight of 408.32 g/mol. Its IUPAC name is 3-[(2,3,4-trihydroxybenzoyl)amino]-2-[(3,4,5-trihydroxybenzoyl)amino]propanoic acid.
| Compound Name | 3-[(2,3,4-trihydroxybenzoyl)amino]-2-[(3,4,5-trihydroxybenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 15957853 |
| Molecular Formula | C17H16N2O10 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 3-[(2,3,4-trihydroxybenzoyl)amino]-2-[(3,4,5-trihydroxybenzoyl)amino]propanoic acid |
| SMILES | O=C(NC(CNC(=O)c1ccc(O)c(O)c1O)C(=O)O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C17H16N2O10/c20-9-2-1-7(12(23)14(9)25)16(27)18-5-8(17(28)29)19-15(26)6-3-10(21)13(24)11(22)4-6/h1-4,8,20-25H,5H2,(H,18,27)(H,19,26)(H,28,29) |
| InChIKey | IMVISWRTYOMANL-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 216.88 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|