C9H11NO5 — CID 141183916
2,3,4-trihydroxy-N-(2-hydroxyethyl)benzamide (PubChem CID 141183916) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is 2,3,4-trihydroxy-N-(2-hydroxyethyl)benzamide.
| Compound Name | 2,3,4-trihydroxy-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 141183916 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2,3,4-trihydroxy-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(NCCO)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C9H11NO5/c11-4-3-10-9(15)5-1-2-6(12)8(14)7(5)13/h1-2,11-14H,3-4H2,(H,10,15) |
| InChIKey | JLQXZJQWGOFCFT-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|