C36H39N3O12 — CID 53340849
2,3,4-trihydroxy-N-[[2,4,6-triethyl-3,5-bis[[(2,3,4-trihydroxybenzoyl)amino]methyl]phenyl]methyl]benzamide (PubChem CID 53340849) has the molecular formula C36H39N3O12 and a molecular weight of 705.72 g/mol. Its IUPAC name is 2,3,4-trihydroxy-N-[[2,4,6-triethyl-3,5-bis[[(2,3,4-trihydroxybenzoyl)amino]methyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4-trihydroxy-N-[[2,4,6-triethyl-3,5-bis[[(2,3,4-trihydroxybenzoyl)amino]methyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 53340849 |
| Molecular Formula | C36H39N3O12 |
| Molecular Weight | 705.72 g/mol |
| Exact Mass | 705.25 |
| IUPAC Name | 2,3,4-trihydroxy-N-[[2,4,6-triethyl-3,5-bis[[(2,3,4-trihydroxybenzoyl)amino]methyl]phenyl]methyl]benzamide |
| SMILES | CCc1c(CNC(=O)c2ccc(O)c(O)c2O)c(CC)c(CNC(=O)c2ccc(O)c(O)c2O)c(CC)c1CNC(=O)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C36H39N3O12/c1-4-16-22(13-37-34(49)19-7-10-25(40)31(46)28(19)43)17(5-2)24(15-39-36(51)21-9-12-27(42)33(48)30(21)45)18(6-3)23(16)14-38-35(50)20-8-11-26(41)32(47)29(20)44/h7-12,40-48H,4-6,13-15H2,1-3H3,(H,37,49)(H,38,50)(H,39,51) |
| InChIKey | LJFIJQURHDRQOM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 269.37 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.72 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|