About 2-chloro-N-ethyl-3,4-dihydroxybenzamide
2-chloro-N-ethyl-3,4-dihydroxybenzamide (PubChem CID 131977281) has the molecular formula C9H10ClNO3
and a molecular weight of 215.64 g/mol. Its IUPAC name is 2-chloro-N-ethyl-3,4-dihydroxybenzamide.
Molecular Properties
| Compound Name | 2-chloro-N-ethyl-3,4-dihydroxybenzamide |
| PubChem CID | 131977281 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 2-chloro-N-ethyl-3,4-dihydroxybenzamide |
| SMILES | CCNC(=O)c1ccc(O)c(O)c1Cl |
| InChI | InChI=1S/C9H10ClNO3/c1-2-11-9(14)5-3-4-6(12)8(13)7(5)10/h3-4,12-13H,2H2,1H3,(H,11,14) |
| InChIKey | FRJZYIDMXQMOSR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-ethyl-3,4-dihydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-ethyl-3,4-dihydroxybenzamide?
The IUPAC name of 2-chloro-N-ethyl-3,4-dihydroxybenzamide (CID 131977281) is 2-chloro-N-ethyl-3,4-dihydroxybenzamide.
What is the SMILES notation for 2-chloro-N-ethyl-3,4-dihydroxybenzamide?
The canonical SMILES for 2-chloro-N-ethyl-3,4-dihydroxybenzamide is CCNC(=O)c1ccc(O)c(O)c1Cl.
What is the InChIKey of 2-chloro-N-ethyl-3,4-dihydroxybenzamide?
The InChIKey is FRJZYIDMXQMOSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO3/c1-2-11-9(14)5-3-4-6(12)8(13)7(5)10/h3-4,12-13H,2H2,1H3,(H,11,14).
What are the key properties of 2-chloro-N-ethyl-3,4-dihydroxybenzamide?
2-chloro-N-ethyl-3,4-dihydroxybenzamide has a molecular weight of 215.64 g/mol, XLogP of 1.50, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-ethyl-3,4-dihydroxybenzamide is sourced from PubChem (CID 131977281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).