About 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide
2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide (PubChem CID 118549329) has the molecular formula C18H26ClNO4
and a molecular weight of 355.86 g/mol. Its IUPAC name is 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide.
Molecular Properties
| Compound Name | 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide |
| PubChem CID | 118549329 |
| Molecular Formula | C18H26ClNO4 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide |
| SMILES | CCCC(CC)(CCC)CNC(=O)C(=O)c1ccc(O)c(O)c1Cl |
| InChI | InChI=1S/C18H26ClNO4/c1-4-9-18(6-3,10-5-2)11-20-17(24)15(22)12-7-8-13(21)16(23)14(12)19/h7-8,21,23H,4-6,9-11H2,1-3H3,(H,20,24) |
| InChIKey | VUHMIZPIWIFFNW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide?
The IUPAC name of 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide (CID 118549329) is 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide.
What is the SMILES notation for 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide?
The canonical SMILES for 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide is CCCC(CC)(CCC)CNC(=O)C(=O)c1ccc(O)c(O)c1Cl.
What is the InChIKey of 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide?
The InChIKey is VUHMIZPIWIFFNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26ClNO4/c1-4-9-18(6-3,10-5-2)11-20-17(24)15(22)12-7-8-13(21)16(23)14(12)19/h7-8,21,23H,4-6,9-11H2,1-3H3,(H,20,24).
What are the key properties of 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide?
2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide has a molecular weight of 355.86 g/mol, XLogP of 4.05, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-3,4-dihydroxyphenyl)-N-(2-ethyl-2-propylpentyl)-2-oxoacetamide is sourced from PubChem (CID 118549329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).