C20H20ClN5O8S — CID 153349463
(2S)-2-[3-[(E)-2-[[2-(2-chloro-3,4-dihydroxyphenyl)-2-oxoacetyl]amino]ethylideneamino]-5-methyl-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid (PubChem CID 153349463) has the molecular formula C20H20ClN5O8S and a molecular weight of 525.93 g/mol. Its IUPAC name is (2S)-2-[3-[(E)-2-[[2-(2-chloro-3,4-dihydroxyphenyl)-2-oxoacetyl]amino]ethylideneamino]-5-methyl-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid.
| Compound Name | (2S)-2-[3-[(E)-2-[[2-(2-chloro-3,4-dihydroxyphenyl)-2-oxoacetyl]amino]ethylideneamino]-5-methyl-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 153349463 |
| Molecular Formula | C20H20ClN5O8S |
| Molecular Weight | 525.93 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | (2S)-2-[3-[(E)-2-[[2-(2-chloro-3,4-dihydroxyphenyl)-2-oxoacetyl]amino]ethylideneamino]-5-methyl-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid |
| SMILES | CC1CN(/N=C/CNC(=O)C(=O)c2ccc(O)c(O)c2Cl)C(=O)N1[C@@H]1C(C(=O)O)SC2CC(=O)N21 |
| InChI | InChI=1S/C20H20ClN5O8S/c1-8-7-24(20(34)25(8)18-16(19(32)33)35-12-6-11(28)26(12)18)23-5-4-22-17(31)14(29)9-2-3-10(27)15(30)13(9)21/h2-3,5,8,12,16,18,27,30H,4,6-7H2,1H3,(H,22,31)(H,32,33)/b23-5+/t8?,12?,16?,18-/m0/s1 |
| InChIKey | JAIURAWAVIJBLE-CWISJMRRSA-N |
| XLogP | 0.25 |
| TPSA | 180.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.93 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|