C15H21BrClNO — CID 114164820
N-[2-(bromomethyl)-2-ethylbutyl]-2-chloro-3-methylbenzamide (PubChem CID 114164820) has the molecular formula C15H21BrClNO and a molecular weight of 346.70 g/mol. Its IUPAC name is N-[2-(bromomethyl)-2-ethylbutyl]-2-chloro-3-methylbenzamide.
| Compound Name | N-[2-(bromomethyl)-2-ethylbutyl]-2-chloro-3-methylbenzamide |
|---|---|
| PubChem CID | 114164820 |
| Molecular Formula | C15H21BrClNO |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | N-[2-(bromomethyl)-2-ethylbutyl]-2-chloro-3-methylbenzamide |
| SMILES | CCC(CC)(CBr)CNC(=O)c1cccc(C)c1Cl |
| InChI | InChI=1S/C15H21BrClNO/c1-4-15(5-2,9-16)10-18-14(19)12-8-6-7-11(3)13(12)17/h6-8H,4-5,9-10H2,1-3H3,(H,18,19) |
| InChIKey | MUSMEQGMPQSJNU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|