C11H11Cl2NO — CID 115766012
2-chloro-N-(2-chloroprop-2-enyl)-3-methylbenzamide (PubChem CID 115766012) has the molecular formula C11H11Cl2NO and a molecular weight of 244.12 g/mol. Its IUPAC name is 2-chloro-N-(2-chloroprop-2-enyl)-3-methylbenzamide.
| Compound Name | 2-chloro-N-(2-chloroprop-2-enyl)-3-methylbenzamide |
|---|---|
| PubChem CID | 115766012 |
| Molecular Formula | C11H11Cl2NO |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 2-chloro-N-(2-chloroprop-2-enyl)-3-methylbenzamide |
| SMILES | C=C(Cl)CNC(=O)c1cccc(C)c1Cl |
| InChI | InChI=1S/C11H11Cl2NO/c1-7-4-3-5-9(10(7)13)11(15)14-6-8(2)12/h3-5H,2,6H2,1H3,(H,14,15) |
| InChIKey | XBNTZNBVXFPLHT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |