C12H13Cl2NO3 — CID 103492705
methyl 2-chloro-3-[(2-chloro-3-methylbenzoyl)amino]propanoate (PubChem CID 103492705) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is methyl 2-chloro-3-[(2-chloro-3-methylbenzoyl)amino]propanoate.
| Compound Name | methyl 2-chloro-3-[(2-chloro-3-methylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 103492705 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | methyl 2-chloro-3-[(2-chloro-3-methylbenzoyl)amino]propanoate |
| SMILES | COC(=O)C(Cl)CNC(=O)c1cccc(C)c1Cl |
| InChI | InChI=1S/C12H13Cl2NO3/c1-7-4-3-5-8(10(7)14)11(16)15-6-9(13)12(17)18-2/h3-5,9H,6H2,1-2H3,(H,15,16) |
| InChIKey | AZRAGWOOPPGMEU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|