C10H10Cl2N2O3 — CID 103492919
methyl 2-chloro-3-[(5-chloropyridine-2-carbonyl)amino]propanoate (PubChem CID 103492919) has the molecular formula C10H10Cl2N2O3 and a molecular weight of 277.11 g/mol. Its IUPAC name is methyl 2-chloro-3-[(5-chloropyridine-2-carbonyl)amino]propanoate.
| Compound Name | methyl 2-chloro-3-[(5-chloropyridine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 103492919 |
| Molecular Formula | C10H10Cl2N2O3 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | methyl 2-chloro-3-[(5-chloropyridine-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(Cl)CNC(=O)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C10H10Cl2N2O3/c1-17-10(16)7(12)5-14-9(15)8-3-2-6(11)4-13-8/h2-4,7H,5H2,1H3,(H,14,15) |
| InChIKey | VJSHFAHURUXBOY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|