C12H12Cl3NO3 — CID 103492991
methyl 2-chloro-3-[[2-(3,4-dichlorophenyl)acetyl]amino]propanoate (PubChem CID 103492991) has the molecular formula C12H12Cl3NO3 and a molecular weight of 324.59 g/mol. Its IUPAC name is methyl 2-chloro-3-[[2-(3,4-dichlorophenyl)acetyl]amino]propanoate.
| Compound Name | methyl 2-chloro-3-[[2-(3,4-dichlorophenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 103492991 |
| Molecular Formula | C12H12Cl3NO3 |
| Molecular Weight | 324.59 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | methyl 2-chloro-3-[[2-(3,4-dichlorophenyl)acetyl]amino]propanoate |
| SMILES | COC(=O)C(Cl)CNC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl3NO3/c1-19-12(18)10(15)6-16-11(17)5-7-2-3-8(13)9(14)4-7/h2-4,10H,5-6H2,1H3,(H,16,17) |
| InChIKey | WKZZMJRYBRXALR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.59 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|