About 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid
2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid (PubChem CID 65220573) has the molecular formula C14H17Cl2NO3
and a molecular weight of 318.20 g/mol. Its IUPAC name is 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid |
| PubChem CID | 65220573 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(CNC(=O)Cc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C14H17Cl2NO3/c1-8(2)10(14(19)20)7-17-13(18)6-9-3-4-11(15)12(16)5-9/h3-5,8,10H,6-7H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | HVHYRNROQVEVRB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid?
The IUPAC name of 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid (CID 65220573) is 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid.
What is the SMILES notation for 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid?
The canonical SMILES for 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid is CC(C)C(CNC(=O)Cc1ccc(Cl)c(Cl)c1)C(=O)O.
What is the InChIKey of 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid?
The InChIKey is HVHYRNROQVEVRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2NO3/c1-8(2)10(14(19)20)7-17-13(18)6-9-3-4-11(15)12(16)5-9/h3-5,8,10H,6-7H2,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid?
2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid has a molecular weight of 318.20 g/mol, XLogP of 3.01, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[2-(3,4-dichlorophenyl)acetyl]amino]methyl]-3-methylbutanoic acid is sourced from PubChem (CID 65220573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).