C11H12ClNO4 — CID 107833154
(2S)-3-[(2-chloro-3-methylbenzoyl)amino]-2-hydroxypropanoic acid (PubChem CID 107833154) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is (2S)-3-[(2-chloro-3-methylbenzoyl)amino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[(2-chloro-3-methylbenzoyl)amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107833154 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (2S)-3-[(2-chloro-3-methylbenzoyl)amino]-2-hydroxypropanoic acid |
| SMILES | Cc1cccc(C(=O)NC[C@H](O)C(=O)O)c1Cl |
| InChI | InChI=1S/C11H12ClNO4/c1-6-3-2-4-7(9(6)12)10(15)13-5-8(14)11(16)17/h2-4,8,14H,5H2,1H3,(H,13,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | JAJUEUQWDCNMPC-QMMMGPOBSA-N |
| XLogP | 0.82 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |